C18H31NO4 — CID 142205938
2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid (PubChem CID 142205938) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid.
| Compound Name | 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid |
|---|---|
| PubChem CID | 142205938 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-[4-[2-[(E)-oct-1-enyl]-5-oxopyrrolidin-1-yl]butoxy]acetic acid |
| SMILES | CCCCCC/C=C/C1CCC(=O)N1CCCCOCC(=O)O |
| InChI | InChI=1S/C18H31NO4/c1-2-3-4-5-6-7-10-16-11-12-17(20)19(16)13-8-9-14-23-15-18(21)22/h7,10,16H,2-6,8-9,11-15H2,1H3,(H,21,22)/b10-7+ |
| InChIKey | HUMKKTOCNYYJSL-JXMROGBWSA-N |
| XLogP | 3.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|