C18H27NO5 — CID 152607005
2-[(Z)-4-[(5R)-2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]but-2-enoxy]acetic acid (PubChem CID 152607005) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(Z)-4-[(5R)-2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[(Z)-4-[(5R)-2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 152607005 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[(Z)-4-[(5R)-2-oxo-5-[(E)-3-oxooct-1-enyl]pyrrolidin-1-yl]but-2-enoxy]acetic acid |
| SMILES | CCCCCC(=O)/C=C/[C@H]1CCC(=O)N1C/C=C\COCC(=O)O |
| InChI | InChI=1S/C18H27NO5/c1-2-3-4-7-16(20)10-8-15-9-11-17(21)19(15)12-5-6-13-24-14-18(22)23/h5-6,8,10,15H,2-4,7,9,11-14H2,1H3,(H,22,23)/b6-5-,10-8+/t15-/m0/s1 |
| InChIKey | YYSQCZUPTUPAAH-WFQNQFOHSA-N |
| XLogP | 2.34 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|