C17H20F2N2O — CID 142206003
(3Z,5E)-4,6-difluoro-1-(4-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one (PubChem CID 142206003) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is (3Z,5E)-4,6-difluoro-1-(4-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one.
| Compound Name | (3Z,5E)-4,6-difluoro-1-(4-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 142206003 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3Z,5E)-4,6-difluoro-1-(4-methyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one |
| SMILES | C/C=C\C(C(=O)Cc1nc2c([nH]1)CCCC2C)=C(F)/C=C/F |
| InChI | InChI=1S/C17H20F2N2O/c1-3-5-12(13(19)8-9-18)15(22)10-16-20-14-7-4-6-11(2)17(14)21-16/h3,5,8-9,11H,4,6-7,10H2,1-2H3,(H,20,21)/b5-3-,9-8+,13-12- |
| InChIKey | YSFNCXMGDUAUNN-NVZQOVKISA-N |
| XLogP | 4.24 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|