C17H20N2O — CID 142206626
1-(4-ethylphenyl)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)urea (PubChem CID 142206626) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)urea.
| Compound Name | 1-(4-ethylphenyl)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)urea |
|---|---|
| PubChem CID | 142206626 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-(4-ethylphenyl)-3-(4-methylcyclohepta-1,3,6-trien-1-yl)urea |
| SMILES | CCc1ccc(NC(=O)NC2=CC=C(C)CC=C2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-3-14-8-11-16(12-9-14)19-17(20)18-15-6-4-5-13(2)7-10-15/h4,6-12H,3,5H2,1-2H3,(H2,18,19,20) |
| InChIKey | UWEKYERWNVSKKR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |