C25H34N2O6S — CID 142206871
formaldehyde;7-formyl-N-hydroxy-2,3-dimethoxycyclohepta-1,4,6-triene-1-carboxamide;1-methyl-4-(3-methylphenyl)sulfanylpiperidine (PubChem CID 142206871) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is formaldehyde;7-formyl-N-hydroxy-2,3-dimethoxycyclohepta-1,4,6-triene-1-carboxamide;1-methyl-4-(3-methylphenyl)sulfanylpiperidine.
| Compound Name | formaldehyde;7-formyl-N-hydroxy-2,3-dimethoxycyclohepta-1,4,6-triene-1-carboxamide;1-methyl-4-(3-methylphenyl)sulfanylpiperidine |
|---|---|
| PubChem CID | 142206871 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | formaldehyde;7-formyl-N-hydroxy-2,3-dimethoxycyclohepta-1,4,6-triene-1-carboxamide;1-methyl-4-(3-methylphenyl)sulfanylpiperidine |
| SMILES | C=O.COC1=C(C(=O)NO)C(C=O)=CC=CC1OC.Cc1cccc(SC2CCN(C)CC2)c1 |
| InChI | InChI=1S/C13H19NS.C11H13NO5.CH2O/c1-11-4-3-5-13(10-11)15-12-6-8-14(2)9-7-12;1-16-8-5-3-4-7(6-13)9(10(8)17-2)11(14)12-15;1-2/h3-5,10,12H,6-9H2,1-2H3;3-6,8,15H,1-2H3,(H,12,14);1H2 |
| InChIKey | QUUZLHNFMQDONQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|