C18H29ClN4O2S — CID 154896418
[(4S)-4-amino-5-[4-(3-methylphenyl)sulfanylpiperidin-1-yl]-5-oxopentyl]urea;hydrochloride (PubChem CID 154896418) has the molecular formula C18H29ClN4O2S and a molecular weight of 400.98 g/mol. Its IUPAC name is [(4S)-4-amino-5-[4-(3-methylphenyl)sulfanylpiperidin-1-yl]-5-oxopentyl]urea;hydrochloride.
| Compound Name | [(4S)-4-amino-5-[4-(3-methylphenyl)sulfanylpiperidin-1-yl]-5-oxopentyl]urea;hydrochloride |
|---|---|
| PubChem CID | 154896418 |
| Molecular Formula | C18H29ClN4O2S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(4S)-4-amino-5-[4-(3-methylphenyl)sulfanylpiperidin-1-yl]-5-oxopentyl]urea;hydrochloride |
| SMILES | Cc1cccc(SC2CCN(C(=O)[C@@H](N)CCCNC(N)=O)CC2)c1.Cl |
| InChI | InChI=1S/C18H28N4O2S.ClH/c1-13-4-2-5-15(12-13)25-14-7-10-22(11-8-14)17(23)16(19)6-3-9-21-18(20)24;/h2,4-5,12,14,16H,3,6-11,19H2,1H3,(H3,20,21,24);1H/t16-;/m0./s1 |
| InChIKey | CQAMGALFNAYIEI-NTISSMGPSA-N |
| XLogP | 2.28 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|