C23H31N — CID 142207028
N-[1-(4-heptylphenyl)ethenyl]-N,4-dimethylaniline (PubChem CID 142207028) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is N-[1-(4-heptylphenyl)ethenyl]-N,4-dimethylaniline.
| Compound Name | N-[1-(4-heptylphenyl)ethenyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 142207028 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | N-[1-(4-heptylphenyl)ethenyl]-N,4-dimethylaniline |
| SMILES | C=C(c1ccc(CCCCCCC)cc1)N(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H31N/c1-5-6-7-8-9-10-21-13-15-22(16-14-21)20(3)24(4)23-17-11-19(2)12-18-23/h11-18H,3,5-10H2,1-2,4H3 |
| InChIKey | NDBLALXPGVIZDK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|