C13H13N — CID 142207417
3-(4-methylcyclohepta-1,3,6-trien-1-yl)pyridine (PubChem CID 142207417) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(4-methylcyclohepta-1,3,6-trien-1-yl)pyridine.
| Compound Name | 3-(4-methylcyclohepta-1,3,6-trien-1-yl)pyridine |
|---|---|
| PubChem CID | 142207417 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-(4-methylcyclohepta-1,3,6-trien-1-yl)pyridine |
| SMILES | CC1=CC=C(c2cccnc2)C=CC1 |
| InChI | InChI=1S/C13H13N/c1-11-4-2-5-12(8-7-11)13-6-3-9-14-10-13/h2-3,5-10H,4H2,1H3 |
| InChIKey | FDONHURLSZGBKH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |