C25H26F3N5O2 — CID 142207935
(E)-2-(methyliminomethyl)but-2-enenitrile;4-methyl-5-(4-methylphenyl)-N-[4-(trifluoromethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide (PubChem CID 142207935) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is (E)-2-(methyliminomethyl)but-2-enenitrile;4-methyl-5-(4-methylphenyl)-N-[4-(trifluoromethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | (E)-2-(methyliminomethyl)but-2-enenitrile;4-methyl-5-(4-methylphenyl)-N-[4-(trifluoromethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 142207935 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (E)-2-(methyliminomethyl)but-2-enenitrile;4-methyl-5-(4-methylphenyl)-N-[4-(trifluoromethoxy)phenyl]-3,4-dihydropyrazole-2-carboxamide |
| SMILES | C/C=C(C#N)\C=N\C.Cc1ccc(C2=NN(C(=O)Nc3ccc(OC(F)(F)F)cc3)CC2C)cc1 |
| InChI | InChI=1S/C19H18F3N3O2.C6H8N2/c1-12-3-5-14(6-4-12)17-13(2)11-25(24-17)18(26)23-15-7-9-16(10-8-15)27-19(20,21)22;1-3-6(4-7)5-8-2/h3-10,13H,11H2,1-2H3,(H,23,26);3,5H,1-2H3/b;6-3-,8-5+ |
| InChIKey | OABFBISNSZNEGR-WKMKRSPLSA-N |
| XLogP | 5.94 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|