About methylcyclobutane;(Z)-4-methylhex-2-ene
methylcyclobutane;(Z)-4-methylhex-2-ene (PubChem CID 142208255) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is methylcyclobutane;(Z)-4-methylhex-2-ene.
Molecular Properties
| Compound Name | methylcyclobutane;(Z)-4-methylhex-2-ene |
| PubChem CID | 142208255 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | methylcyclobutane;(Z)-4-methylhex-2-ene |
| SMILES | C/C=C\C(C)CC.CC1CCC1 |
| InChI | InChI=1S/C7H14.C5H10/c1-4-6-7(3)5-2;1-5-3-2-4-5/h4,6-7H,5H2,1-3H3;5H,2-4H2,1H3/b6-4-; |
| InChIKey | WSEXBLQRGQYFHM-YHSAGPEESA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methylcyclobutane;(Z)-4-methylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclobutane;(Z)-4-methylhex-2-ene?
The IUPAC name of methylcyclobutane;(Z)-4-methylhex-2-ene (CID 142208255) is methylcyclobutane;(Z)-4-methylhex-2-ene.
What is the SMILES notation for methylcyclobutane;(Z)-4-methylhex-2-ene?
The canonical SMILES for methylcyclobutane;(Z)-4-methylhex-2-ene is C/C=C\C(C)CC.CC1CCC1.
What is the InChIKey of methylcyclobutane;(Z)-4-methylhex-2-ene?
The InChIKey is WSEXBLQRGQYFHM-YHSAGPEESA-N. The full InChI is InChI=1S/C7H14.C5H10/c1-4-6-7(3)5-2;1-5-3-2-4-5/h4,6-7H,5H2,1-3H3;5H,2-4H2,1H3/b6-4-;.
What are the key properties of methylcyclobutane;(Z)-4-methylhex-2-ene?
methylcyclobutane;(Z)-4-methylhex-2-ene has a molecular weight of 168.32 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclobutane;(Z)-4-methylhex-2-ene is sourced from PubChem (CID 142208255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).