C35H70 — CID 160868855
1-ethyl-2-methylcyclopentane;1-ethyl-2-methylcyclopropane;hex-3-ene;(E)-4-methyloct-2-ene;3-methylpent-1-ene (PubChem CID 160868855) has the molecular formula C35H70 and a molecular weight of 490.95 g/mol. Its IUPAC name is 1-ethyl-2-methylcyclopentane;1-ethyl-2-methylcyclopropane;hex-3-ene;(E)-4-methyloct-2-ene;3-methylpent-1-ene.
| Compound Name | 1-ethyl-2-methylcyclopentane;1-ethyl-2-methylcyclopropane;hex-3-ene;(E)-4-methyloct-2-ene;3-methylpent-1-ene |
|---|---|
| PubChem CID | 160868855 |
| Molecular Formula | C35H70 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.55 |
| IUPAC Name | 1-ethyl-2-methylcyclopentane;1-ethyl-2-methylcyclopropane;hex-3-ene;(E)-4-methyloct-2-ene;3-methylpent-1-ene |
| SMILES | C/C=C/C(C)CCCC.C=CC(C)CC.CCC1CC1C.CCC1CCCC1C.CCC=CCC |
| InChI | InChI=1S/C9H18.C8H16.3C6H12/c1-4-6-8-9(3)7-5-2;1-3-8-6-4-5-7(8)2;1-3-6-4-5(6)2;1-4-6(3)5-2;1-3-5-6-4-2/h5,7,9H,4,6,8H2,1-3H3;7-8H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3;4,6H,1,5H2,2-3H3;5-6H,3-4H2,1-2H3/b7-5+;;;; |
| InChIKey | SLMNWVKRDRBRCU-IGFSWITOSA-N |
| XLogP | 12.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|