C18H36O — CID 158094227
2,3-diethyloxirane;(E)-hex-3-ene;3-methylpent-1-ene (PubChem CID 158094227) has the molecular formula C18H36O and a molecular weight of 268.48 g/mol. Its IUPAC name is 2,3-diethyloxirane;(E)-hex-3-ene;3-methylpent-1-ene.
| Compound Name | 2,3-diethyloxirane;(E)-hex-3-ene;3-methylpent-1-ene |
|---|---|
| PubChem CID | 158094227 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | 2,3-diethyloxirane;(E)-hex-3-ene;3-methylpent-1-ene |
| SMILES | C=CC(C)CC.CC/C=C/CC.CCC1OC1CC |
| InChI | InChI=1S/C6H12O.2C6H12/c1-3-5-6(4-2)7-5;1-4-6(3)5-2;1-3-5-6-4-2/h5-6H,3-4H2,1-2H3;4,6H,1,5H2,2-3H3;5-6H,3-4H2,1-2H3/b;;6-5+ |
| InChIKey | FOMBFBMEDMWDMM-PNVBZASYSA-N |
| XLogP | 6.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|