C10H22O2 — CID 174728518
butan-2-ol;2,3-diethyloxirane (PubChem CID 174728518) has the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. Its IUPAC name is butan-2-ol;2,3-diethyloxirane.
| Compound Name | butan-2-ol;2,3-diethyloxirane |
|---|---|
| PubChem CID | 174728518 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | butan-2-ol;2,3-diethyloxirane |
| SMILES | CCC(C)O.CCC1OC1CC |
| InChI | InChI=1S/C6H12O.C4H10O/c1-3-5-6(4-2)7-5;1-3-4(2)5/h5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | CHJFYDGHOLMTLO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|