About butan-2-ol;2,3-diethyloxirane
butan-2-ol;2,3-diethyloxirane (PubChem CID 174728518) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is butan-2-ol;2,3-diethyloxirane.
Molecular Properties
| Compound Name | butan-2-ol;2,3-diethyloxirane |
| PubChem CID | 174728518 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | butan-2-ol;2,3-diethyloxirane |
| SMILES | CCC(C)O.CCC1OC1CC |
| InChI | InChI=1S/C6H12O.C4H10O/c1-3-5-6(4-2)7-5;1-3-4(2)5/h5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | CHJFYDGHOLMTLO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;2,3-diethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;2,3-diethyloxirane?
The IUPAC name of butan-2-ol;2,3-diethyloxirane (CID 174728518) is butan-2-ol;2,3-diethyloxirane.
What is the SMILES notation for butan-2-ol;2,3-diethyloxirane?
The canonical SMILES for butan-2-ol;2,3-diethyloxirane is CCC(C)O.CCC1OC1CC.
What is the InChIKey of butan-2-ol;2,3-diethyloxirane?
The InChIKey is CHJFYDGHOLMTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C4H10O/c1-3-5-6(4-2)7-5;1-3-4(2)5/h5-6H,3-4H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of butan-2-ol;2,3-diethyloxirane?
butan-2-ol;2,3-diethyloxirane has a molecular weight of 174.28 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;2,3-diethyloxirane is sourced from PubChem (CID 174728518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).