C6H10O — CID 134927722
(2S,3S)-2-ethenyl-3-ethyloxirane (PubChem CID 134927722) has the molecular formula C6H10O and a molecular weight of 98.14 g/mol. Its IUPAC name is (2S,3S)-2-ethenyl-3-ethyloxirane.
| Compound Name | (2S,3S)-2-ethenyl-3-ethyloxirane |
|---|---|
| PubChem CID | 134927722 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | (2S,3S)-2-ethenyl-3-ethyloxirane |
| SMILES | C=C[C@@H]1O[C@H]1CC |
| InChI | InChI=1S/C6H10O/c1-3-5-6(4-2)7-5/h3,5-6H,1,4H2,2H3/t5-,6-/m0/s1 |
| InChIKey | AMXASLDHSQRSDI-WDSKDSINSA-N |
| XLogP | 1.35 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|