C6H12N2O2 — CID 129016843
N-[[[(2S,3R)-3-ethenyloxiran-2-yl]methylamino]methyl]hydroxylamine (PubChem CID 129016843) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is N-[[[(2S,3R)-3-ethenyloxiran-2-yl]methylamino]methyl]hydroxylamine.
| Compound Name | N-[[[(2S,3R)-3-ethenyloxiran-2-yl]methylamino]methyl]hydroxylamine |
|---|---|
| PubChem CID | 129016843 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | N-[[[(2S,3R)-3-ethenyloxiran-2-yl]methylamino]methyl]hydroxylamine |
| SMILES | C=C[C@H]1O[C@H]1CNCNO |
| InChI | InChI=1S/C6H12N2O2/c1-2-5-6(10-5)3-7-4-8-9/h2,5-9H,1,3-4H2/t5-,6+/m1/s1 |
| InChIKey | WVCYTXODIVECLI-RITPCOANSA-N |
| XLogP | -0.53 |
| TPSA | 56.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|