C10H14O3 — CID 89260424
(Z)-6-(3-ethenyloxiran-2-yl)hex-4-enoic acid (PubChem CID 89260424) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (Z)-6-(3-ethenyloxiran-2-yl)hex-4-enoic acid.
| Compound Name | (Z)-6-(3-ethenyloxiran-2-yl)hex-4-enoic acid |
|---|---|
| PubChem CID | 89260424 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (Z)-6-(3-ethenyloxiran-2-yl)hex-4-enoic acid |
| SMILES | C=CC1OC1C/C=C\CCC(=O)O |
| InChI | InChI=1S/C10H14O3/c1-2-8-9(13-8)6-4-3-5-7-10(11)12/h2-4,8-9H,1,5-7H2,(H,11,12)/b4-3- |
| InChIKey | VTYIKIPGYOTACZ-ARJAWSKDSA-N |
| XLogP | 1.75 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|