C10H13IO4 — CID 89111969
iodomethyl (Z)-6-(3-formyloxiran-2-yl)hex-4-enoate (PubChem CID 89111969) has the molecular formula C10H13IO4 and a molecular weight of 324.11 g/mol. Its IUPAC name is iodomethyl (Z)-6-(3-formyloxiran-2-yl)hex-4-enoate.
| Compound Name | iodomethyl (Z)-6-(3-formyloxiran-2-yl)hex-4-enoate |
|---|---|
| PubChem CID | 89111969 |
| Molecular Formula | C10H13IO4 |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | iodomethyl (Z)-6-(3-formyloxiran-2-yl)hex-4-enoate |
| SMILES | O=CC1OC1C/C=C\CCC(=O)OCI |
| InChI | InChI=1S/C10H13IO4/c11-7-14-10(13)5-3-1-2-4-8-9(6-12)15-8/h1-2,6,8-9H,3-5,7H2/b2-1- |
| InChIKey | ORIZHFCOUDSQPX-UPHRSURJSA-N |
| XLogP | 1.61 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|