C38H62O6 — CID 157005551
[(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13Z)-15-[3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoate (PubChem CID 157005551) has the molecular formula C38H62O6 and a molecular weight of 614.91 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13Z)-15-[3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoate.
| Compound Name | [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13Z)-15-[3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoate |
|---|---|
| PubChem CID | 157005551 |
| Molecular Formula | C38H62O6 |
| Molecular Weight | 614.91 g/mol |
| Exact Mass | 614.45 |
| IUPAC Name | [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (4Z,7Z,10Z,13Z)-15-[3-[(Z)-pent-2-enyl]oxiran-2-yl]pentadeca-4,7,10,13-tetraenoate |
| SMILES | CC/C=C\CC1OC1C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C38H62O6/c1-4-6-21-27-35-36(44-35)28-23-18-13-11-9-7-8-10-12-14-19-24-29-37(40)42-32-34(31-39)43-38(41)30-25-20-16-15-17-22-26-33(3)5-2/h6,8-11,14,18-19,21,23,33-36,39H,4-5,7,12-13,15-17,20,22,24-32H2,1-3H3/b10-8-,11-9-,19-14-,21-6-,23-18-/t33?,34-,35?,36?/m0/s1 |
| InChIKey | GZPPMIJXWNCJCV-NBDOYDAVSA-N |
| XLogP | 9.29 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.91 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|