C31H52O6 — CID 157005170
[(2S)-3-hydroxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] octanoate (PubChem CID 157005170) has the molecular formula C31H52O6 and a molecular weight of 520.75 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] octanoate.
| Compound Name | [(2S)-3-hydroxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] octanoate |
|---|---|
| PubChem CID | 157005170 |
| Molecular Formula | C31H52O6 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | [(2S)-3-hydroxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] octanoate |
| SMILES | CCCCC/C=C\C/C=C\CC1OC1C/C=C\CCCC(=O)O[C@@H](CO)COC(=O)CCCCCCC |
| InChI | InChI=1S/C31H52O6/c1-3-5-7-9-10-11-12-14-17-21-28-29(37-28)22-18-15-16-20-24-31(34)36-27(25-32)26-35-30(33)23-19-13-8-6-4-2/h10-11,14-15,17-18,27-29,32H,3-9,12-13,16,19-26H2,1-2H3/b11-10-,17-14-,18-15-/t27-,28?,29?/m0/s1 |
| InChIKey | LOJVICZEYOPQAG-HMPDLOGDSA-N |
| XLogP | 7.15 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|