C25H40O6 — CID 157004963
[(2S)-2-acetyloxy-3-hydroxypropyl] (Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoate (PubChem CID 157004963) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-3-hydroxypropyl] (Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoate.
| Compound Name | [(2S)-2-acetyloxy-3-hydroxypropyl] (Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 157004963 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(2S)-2-acetyloxy-3-hydroxypropyl] (Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoate |
| SMILES | CCCCC/C=C\C/C=C\CC1OC1C/C=C\CCCC(=O)OC[C@H](CO)OC(C)=O |
| InChI | InChI=1S/C25H40O6/c1-3-4-5-6-7-8-9-10-13-16-23-24(31-23)17-14-11-12-15-18-25(28)29-20-22(19-26)30-21(2)27/h7-8,10-11,13-14,22-24,26H,3-6,9,12,15-20H2,1-2H3/b8-7-,13-10-,14-11-/t22-,23?,24?/m0/s1 |
| InChIKey | ABDCTJHQQPVSCN-HVISQOBZSA-N |
| XLogP | 4.81 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|