C25H21F3N2O3 — CID 142209511
2-ethoxy-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]benzimidazol-2-yl]methyl]benzoic acid (PubChem CID 142209511) has the molecular formula C25H21F3N2O3 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-ethoxy-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]benzimidazol-2-yl]methyl]benzoic acid.
| Compound Name | 2-ethoxy-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]benzimidazol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 142209511 |
| Molecular Formula | C25H21F3N2O3 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-ethoxy-4-[[1-[[2-(trifluoromethyl)phenyl]methyl]benzimidazol-2-yl]methyl]benzoic acid |
| SMILES | CCOc1cc(Cc2nc3ccccc3n2Cc2ccccc2C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C25H21F3N2O3/c1-2-33-22-13-16(11-12-18(22)24(31)32)14-23-29-20-9-5-6-10-21(20)30(23)15-17-7-3-4-8-19(17)25(26,27)28/h3-13H,2,14-15H2,1H3,(H,31,32) |
| InChIKey | SDBCURCNVANDOL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |