C19H18FN3O2 — CID 142210614
6-(cyclopropylamino)-2-[2-fluoro-4-(methylamino)phenyl]-4H-isoquinoline-1,3-dione (PubChem CID 142210614) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 6-(cyclopropylamino)-2-[2-fluoro-4-(methylamino)phenyl]-4H-isoquinoline-1,3-dione.
| Compound Name | 6-(cyclopropylamino)-2-[2-fluoro-4-(methylamino)phenyl]-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 142210614 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 6-(cyclopropylamino)-2-[2-fluoro-4-(methylamino)phenyl]-4H-isoquinoline-1,3-dione |
| SMILES | CNc1ccc(N2C(=O)Cc3cc(NC4CC4)ccc3C2=O)c(F)c1 |
| InChI | InChI=1S/C19H18FN3O2/c1-21-13-5-7-17(16(20)10-13)23-18(24)9-11-8-14(22-12-2-3-12)4-6-15(11)19(23)25/h4-8,10,12,21-22H,2-3,9H2,1H3 |
| InChIKey | INFKNSAJDAICKA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|