C12H27N2O5P — CID 142210960
(2-amino-3-butoxypropyl) 2-aminoethyl prop-2-enyl phosphate (PubChem CID 142210960) has the molecular formula C12H27N2O5P and a molecular weight of 310.33 g/mol. Its IUPAC name is (2-amino-3-butoxypropyl) 2-aminoethyl prop-2-enyl phosphate.
| Compound Name | (2-amino-3-butoxypropyl) 2-aminoethyl prop-2-enyl phosphate |
|---|---|
| PubChem CID | 142210960 |
| Molecular Formula | C12H27N2O5P |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2-amino-3-butoxypropyl) 2-aminoethyl prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OCCN)OCC(N)COCCCC |
| InChI | InChI=1S/C12H27N2O5P/c1-3-5-8-16-10-12(14)11-19-20(15,17-7-4-2)18-9-6-13/h4,12H,2-3,5-11,13-14H2,1H3 |
| InChIKey | CBFVPSJYFZLJTJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|