C34H32N4O7 — CID 142211157
(2S)-3-[5-(carboxymethoxy)-1H-indol-3-yl]-2-[[1-cyclohexyl-2-(4-formylphenyl)benzimidazole-5-carbonyl]amino]propanoic acid (PubChem CID 142211157) has the molecular formula C34H32N4O7 and a molecular weight of 608.65 g/mol. Its IUPAC name is (2S)-3-[5-(carboxymethoxy)-1H-indol-3-yl]-2-[[1-cyclohexyl-2-(4-formylphenyl)benzimidazole-5-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-[5-(carboxymethoxy)-1H-indol-3-yl]-2-[[1-cyclohexyl-2-(4-formylphenyl)benzimidazole-5-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142211157 |
| Molecular Formula | C34H32N4O7 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | (2S)-3-[5-(carboxymethoxy)-1H-indol-3-yl]-2-[[1-cyclohexyl-2-(4-formylphenyl)benzimidazole-5-carbonyl]amino]propanoic acid |
| SMILES | O=Cc1ccc(-c2nc3cc(C(=O)N[C@@H](Cc4c[nH]c5ccc(OCC(=O)O)cc45)C(=O)O)ccc3n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C34H32N4O7/c39-18-20-6-8-21(9-7-20)32-36-28-14-22(10-13-30(28)38(32)24-4-2-1-3-5-24)33(42)37-29(34(43)44)15-23-17-35-27-12-11-25(16-26(23)27)45-19-31(40)41/h6-14,16-18,24,29,35H,1-5,15,19H2,(H,37,42)(H,40,41)(H,43,44)/t29-/m0/s1 |
| InChIKey | AKXURUWCGVJJED-LJAQVGFWSA-N |
| XLogP | 5.39 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|