C28H34N4O6 — CID 23378444
methyl 2-[[3-amino-4-(cyclohexylamino)benzoyl]amino]-3-[5-(2-methoxy-2-oxoethoxy)-1H-indol-3-yl]propanoate (PubChem CID 23378444) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is methyl 2-[[3-amino-4-(cyclohexylamino)benzoyl]amino]-3-[5-(2-methoxy-2-oxoethoxy)-1H-indol-3-yl]propanoate.
| Compound Name | methyl 2-[[3-amino-4-(cyclohexylamino)benzoyl]amino]-3-[5-(2-methoxy-2-oxoethoxy)-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 23378444 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | methyl 2-[[3-amino-4-(cyclohexylamino)benzoyl]amino]-3-[5-(2-methoxy-2-oxoethoxy)-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)COc1ccc2[nH]cc(CC(NC(=O)c3ccc(NC4CCCCC4)c(N)c3)C(=O)OC)c2c1 |
| InChI | InChI=1S/C28H34N4O6/c1-36-26(33)16-38-20-9-11-23-21(14-20)18(15-30-23)13-25(28(35)37-2)32-27(34)17-8-10-24(22(29)12-17)31-19-6-4-3-5-7-19/h8-12,14-15,19,25,30-31H,3-7,13,16,29H2,1-2H3,(H,32,34) |
| InChIKey | VQIUIMDUNNAWQW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|