C44H51N9O6 — CID 90718580
3-amino-4-(cyclohexylamino)-N-[(2R)-1-(5-ethoxy-1H-indol-3-yl)propan-2-yl]benzamide;4-azido-N-[2-[[2-(4-formylphenoxy)acetyl]amino]ethyl]benzamide (PubChem CID 90718580) has the molecular formula C44H51N9O6 and a molecular weight of 801.95 g/mol. Its IUPAC name is 3-amino-4-(cyclohexylamino)-N-[(2R)-1-(5-ethoxy-1H-indol-3-yl)propan-2-yl]benzamide;4-azido-N-[2-[[2-(4-formylphenoxy)acetyl]amino]ethyl]benzamide.
| Compound Name | 3-amino-4-(cyclohexylamino)-N-[(2R)-1-(5-ethoxy-1H-indol-3-yl)propan-2-yl]benzamide;4-azido-N-[2-[[2-(4-formylphenoxy)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 90718580 |
| Molecular Formula | C44H51N9O6 |
| Molecular Weight | 801.95 g/mol |
| Exact Mass | 801.40 |
| IUPAC Name | 3-amino-4-(cyclohexylamino)-N-[(2R)-1-(5-ethoxy-1H-indol-3-yl)propan-2-yl]benzamide;4-azido-N-[2-[[2-(4-formylphenoxy)acetyl]amino]ethyl]benzamide |
| SMILES | CCOc1ccc2[nH]cc(C[C@@H](C)NC(=O)c3ccc(NC4CCCCC4)c(N)c3)c2c1.[N-]=[N+]=Nc1ccc(C(=O)NCCNC(=O)COc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O2.C18H17N5O4/c1-3-32-21-10-12-24-22(15-21)19(16-28-24)13-17(2)29-26(31)18-9-11-25(23(27)14-18)30-20-7-5-4-6-8-20;19-23-22-15-5-3-14(4-6-15)18(26)21-10-9-20-17(25)12-27-16-7-1-13(11-24)2-8-16/h9-12,14-17,20,28,30H,3-8,13,27H2,1-2H3,(H,29,31);1-8,11H,9-10,12H2,(H,20,25)(H,21,26)/t17-;/m1./s1 |
| InChIKey | RCDHWVBWCZJMGU-UNTBIKODSA-N |
| XLogP | 7.62 |
| TPSA | 225.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.95 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|