C10H22N2O4 — CID 142211328
2-[carboxymethyl(ethyl)amino]acetic acid;N-methylpropan-1-amine (PubChem CID 142211328) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[carboxymethyl(ethyl)amino]acetic acid;N-methylpropan-1-amine.
| Compound Name | 2-[carboxymethyl(ethyl)amino]acetic acid;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 142211328 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-[carboxymethyl(ethyl)amino]acetic acid;N-methylpropan-1-amine |
| SMILES | CCCNC.CCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H11NO4.C4H11N/c1-2-7(3-5(8)9)4-6(10)11;1-3-4-5-2/h2-4H2,1H3,(H,8,9)(H,10,11);5H,3-4H2,1-2H3 |
| InChIKey | MNPVKRCADYUECV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |