C30H38N4O5 — CID 142212300
[(2S)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl] N-[(3S,4S)-4-methyl-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate (PubChem CID 142212300) has the molecular formula C30H38N4O5 and a molecular weight of 534.66 g/mol. Its IUPAC name is [(2S)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl] N-[(3S,4S)-4-methyl-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate.
| Compound Name | [(2S)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl] N-[(3S,4S)-4-methyl-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 142212300 |
| Molecular Formula | C30H38N4O5 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(2S)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl] N-[(3S,4S)-4-methyl-1,2-dioxo-1-[[(1R)-1-phenylethyl]amino]heptan-3-yl]carbamate |
| SMILES | CCC[C@H](C)[C@H](NC(=O)O[C@@H](Cc1nnc(-c2ccccc2)o1)C(C)C)C(=O)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C30H38N4O5/c1-6-13-20(4)26(27(35)28(36)31-21(5)22-14-9-7-10-15-22)32-30(37)38-24(19(2)3)18-25-33-34-29(39-25)23-16-11-8-12-17-23/h7-12,14-17,19-21,24,26H,6,13,18H2,1-5H3,(H,31,36)(H,32,37)/t20-,21+,24-,26-/m0/s1 |
| InChIKey | GHQXTRGIIWUWRH-IMBWNBOCSA-N |
| XLogP | 5.28 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|