C22H26N4O5 — CID 87987920
[(3S)-1-cyano-1,2-dioxoheptan-3-yl]-[(2R)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl]carbamic acid (PubChem CID 87987920) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is [(3S)-1-cyano-1,2-dioxoheptan-3-yl]-[(2R)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl]carbamic acid.
| Compound Name | [(3S)-1-cyano-1,2-dioxoheptan-3-yl]-[(2R)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87987920 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(3S)-1-cyano-1,2-dioxoheptan-3-yl]-[(2R)-3-methyl-1-(5-phenyl-1,3,4-oxadiazol-2-yl)butan-2-yl]carbamic acid |
| SMILES | CCCC[C@@H](C(=O)C(=O)C#N)N(C(=O)O)[C@H](Cc1nnc(-c2ccccc2)o1)C(C)C |
| InChI | InChI=1S/C22H26N4O5/c1-4-5-11-16(20(28)18(27)13-23)26(22(29)30)17(14(2)3)12-19-24-25-21(31-19)15-9-7-6-8-10-15/h6-10,14,16-17H,4-5,11-12H2,1-3H3,(H,29,30)/t16-,17+/m0/s1 |
| InChIKey | DMJOBGYMTKLCDE-DLBZAZTESA-N |
| XLogP | 3.50 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|