C25H34N6O4S — CID 142212352
[(2S)-3,3-dimethyl-1-(5-pyridin-3-yl-3,4-dihydropyrazol-2-yl)butan-2-yl] N-[(3S)-1,2-dioxo-1-(1,3-thiazol-2-ylamino)heptan-3-yl]carbamate (PubChem CID 142212352) has the molecular formula C25H34N6O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is [(2S)-3,3-dimethyl-1-(5-pyridin-3-yl-3,4-dihydropyrazol-2-yl)butan-2-yl] N-[(3S)-1,2-dioxo-1-(1,3-thiazol-2-ylamino)heptan-3-yl]carbamate.
| Compound Name | [(2S)-3,3-dimethyl-1-(5-pyridin-3-yl-3,4-dihydropyrazol-2-yl)butan-2-yl] N-[(3S)-1,2-dioxo-1-(1,3-thiazol-2-ylamino)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 142212352 |
| Molecular Formula | C25H34N6O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | [(2S)-3,3-dimethyl-1-(5-pyridin-3-yl-3,4-dihydropyrazol-2-yl)butan-2-yl] N-[(3S)-1,2-dioxo-1-(1,3-thiazol-2-ylamino)heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)O[C@H](CN1CCC(c2cccnc2)=N1)C(C)(C)C)C(=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C25H34N6O4S/c1-5-6-9-19(21(32)22(33)29-23-27-12-14-36-23)28-24(34)35-20(25(2,3)4)16-31-13-10-18(30-31)17-8-7-11-26-15-17/h7-8,11-12,14-15,19-20H,5-6,9-10,13,16H2,1-4H3,(H,28,34)(H,27,29,33)/t19-,20+/m0/s1 |
| InChIKey | RXPZTRNPKOCSBL-VQTJNVASSA-N |
| XLogP | 3.86 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|