C24H25NO2 — CID 142213579
1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethenamine (PubChem CID 142213579) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethenamine.
| Compound Name | 1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethenamine |
|---|---|
| PubChem CID | 142213579 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethenamine |
| SMILES | C=C(N)c1cc(OCc2ccccc2C)cc(OCc2ccccc2C)c1 |
| InChI | InChI=1S/C24H25NO2/c1-17-8-4-6-10-20(17)15-26-23-12-22(19(3)25)13-24(14-23)27-16-21-11-7-5-9-18(21)2/h4-14H,3,15-16,25H2,1-2H3 |
| InChIKey | FYLPDKYOCIBDFS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |