C33H39NO3 — CID 142213590
acetylene;1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethanone;N-(2-methylprop-1-enyl)propan-2-imine (PubChem CID 142213590) has the molecular formula C33H39NO3 and a molecular weight of 497.68 g/mol. Its IUPAC name is acetylene;1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethanone;N-(2-methylprop-1-enyl)propan-2-imine.
| Compound Name | acetylene;1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethanone;N-(2-methylprop-1-enyl)propan-2-imine |
|---|---|
| PubChem CID | 142213590 |
| Molecular Formula | C33H39NO3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | acetylene;1-[3,5-bis[(2-methylphenyl)methoxy]phenyl]ethanone;N-(2-methylprop-1-enyl)propan-2-imine |
| SMILES | C#C.CC(=O)c1cc(OCc2ccccc2C)cc(OCc2ccccc2C)c1.CC(C)=CN=C(C)C |
| InChI | InChI=1S/C24H24O3.C7H13N.C2H2/c1-17-8-4-6-10-20(17)15-26-23-12-22(19(3)25)13-24(14-23)27-16-21-11-7-5-9-18(21)2;1-6(2)5-8-7(3)4;1-2/h4-14H,15-16H2,1-3H3;5H,1-4H3;1-2H |
| InChIKey | HSHUEPLLZPKAAJ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|