C21H14Cl2FNO4 — CID 142214479
4-[3,4-dichloro-N-[(6-fluoronaphthalen-2-yl)methyl]anilino]-2,4-dioxobutanoic acid (PubChem CID 142214479) has the molecular formula C21H14Cl2FNO4 and a molecular weight of 434.25 g/mol. Its IUPAC name is 4-[3,4-dichloro-N-[(6-fluoronaphthalen-2-yl)methyl]anilino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[3,4-dichloro-N-[(6-fluoronaphthalen-2-yl)methyl]anilino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 142214479 |
| Molecular Formula | C21H14Cl2FNO4 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 4-[3,4-dichloro-N-[(6-fluoronaphthalen-2-yl)methyl]anilino]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(Cc1ccc2cc(F)ccc2c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2FNO4/c22-17-6-5-16(9-18(17)23)25(20(27)10-19(26)21(28)29)11-12-1-2-14-8-15(24)4-3-13(14)7-12/h1-9H,10-11H2,(H,28,29) |
| InChIKey | CHUVWUGMAHAQJZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|