C19H13Cl2F2NO4 — CID 6478531
4-(3,4-dichloro-N-[(E)-3-(2,4-difluorophenyl)prop-2-enyl]anilino)-2,4-dioxobutanoic acid (PubChem CID 6478531) has the molecular formula C19H13Cl2F2NO4 and a molecular weight of 428.22 g/mol. Its IUPAC name is 4-(3,4-dichloro-N-[(E)-3-(2,4-difluorophenyl)prop-2-enyl]anilino)-2,4-dioxobutanoic acid.
| Compound Name | 4-(3,4-dichloro-N-[(E)-3-(2,4-difluorophenyl)prop-2-enyl]anilino)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 6478531 |
| Molecular Formula | C19H13Cl2F2NO4 |
| Molecular Weight | 428.22 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-(3,4-dichloro-N-[(E)-3-(2,4-difluorophenyl)prop-2-enyl]anilino)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)N(C/C=C/c1ccc(F)cc1F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl2F2NO4/c20-14-6-5-13(9-15(14)21)24(18(26)10-17(25)19(27)28)7-1-2-11-3-4-12(22)8-16(11)23/h1-6,8-9H,7,10H2,(H,27,28)/b2-1+ |
| InChIKey | LRMWUSRZJFKUOU-OWOJBTEDSA-N |
| XLogP | 4.36 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|