C23H23Cl2F2NO4 — CID 505582
tert-butyl 4-[3,4-dichloro-N-[3-(2,4-difluorophenyl)propyl]anilino]-2,4-dioxobutanoate (PubChem CID 505582) has the molecular formula C23H23Cl2F2NO4 and a molecular weight of 486.34 g/mol. Its IUPAC name is tert-butyl 4-[3,4-dichloro-N-[3-(2,4-difluorophenyl)propyl]anilino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[3,4-dichloro-N-[3-(2,4-difluorophenyl)propyl]anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505582 |
| Molecular Formula | C23H23Cl2F2NO4 |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | tert-butyl 4-[3,4-dichloro-N-[3-(2,4-difluorophenyl)propyl]anilino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(CCCc1ccc(F)cc1F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H23Cl2F2NO4/c1-23(2,3)32-22(31)20(29)13-21(30)28(16-8-9-17(24)18(25)12-16)10-4-5-14-6-7-15(26)11-19(14)27/h6-9,11-12H,4-5,10,13H2,1-3H3 |
| InChIKey | CBPSVFQOVKGECC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|