C14H36N4O2 — CID 142215990
N'-acetyl-2-[amino(2-methylpropyl)amino]-N-(2-methylpropyl)acetohydrazide;ethane;molecular hydrogen (PubChem CID 142215990) has the molecular formula C14H36N4O2 and a molecular weight of 292.47 g/mol. Its IUPAC name is N'-acetyl-2-[amino(2-methylpropyl)amino]-N-(2-methylpropyl)acetohydrazide;ethane;molecular hydrogen.
| Compound Name | N'-acetyl-2-[amino(2-methylpropyl)amino]-N-(2-methylpropyl)acetohydrazide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 142215990 |
| Molecular Formula | C14H36N4O2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | N'-acetyl-2-[amino(2-methylpropyl)amino]-N-(2-methylpropyl)acetohydrazide;ethane;molecular hydrogen |
| SMILES | CC.CC(=O)NN(CC(C)C)C(=O)CN(N)CC(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C12H26N4O2.C2H6.2H2/c1-9(2)6-15(13)8-12(18)16(7-10(3)4)14-11(5)17;1-2;;/h9-10H,6-8,13H2,1-5H3,(H,14,17);1-2H3;2*1H |
| InChIKey | SZNHGAMKEWGJTC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|