C32H37F3O2 — CID 142216291
1-butoxy-4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene;1-ethoxyethenylbenzene (PubChem CID 142216291) has the molecular formula C32H37F3O2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 1-butoxy-4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene;1-ethoxyethenylbenzene.
| Compound Name | 1-butoxy-4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene;1-ethoxyethenylbenzene |
|---|---|
| PubChem CID | 142216291 |
| Molecular Formula | C32H37F3O2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 1-butoxy-4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-enyl]benzene;1-ethoxyethenylbenzene |
| SMILES | C=C(C)C(Cc1ccc(OCCCC)cc1)c1ccc(C(F)(F)F)cc1.C=C(OCC)c1ccccc1 |
| InChI | InChI=1S/C22H25F3O.C10H12O/c1-4-5-14-26-20-12-6-17(7-13-20)15-21(16(2)3)18-8-10-19(11-9-18)22(23,24)25;1-3-11-9(2)10-7-5-4-6-8-10/h6-13,21H,2,4-5,14-15H2,1,3H3;4-8H,2-3H2,1H3 |
| InChIKey | ZSIAFBXFANKZJD-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|