C16H17NO — CID 142217496
N-(3-bicyclo[4.1.0]hepta-2,4-dienylmethyl)-4-methylbenzamide (PubChem CID 142217496) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is N-(3-bicyclo[4.1.0]hepta-2,4-dienylmethyl)-4-methylbenzamide.
| Compound Name | N-(3-bicyclo[4.1.0]hepta-2,4-dienylmethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 142217496 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(3-bicyclo[4.1.0]hepta-2,4-dienylmethyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC2=CC3CC3C=C2)cc1 |
| InChI | InChI=1S/C16H17NO/c1-11-2-5-13(6-3-11)16(18)17-10-12-4-7-14-9-15(14)8-12/h2-8,14-15H,9-10H2,1H3,(H,17,18) |
| InChIKey | NDIKDZVPHRTIAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |