C35H48N4O5 — CID 142218477
ethane;N-ethyl-4-methoxypent-4-en-1-amine;1-[2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxy]ethyl]piperidine-4-carboxylic acid (PubChem CID 142218477) has the molecular formula C35H48N4O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is ethane;N-ethyl-4-methoxypent-4-en-1-amine;1-[2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxy]ethyl]piperidine-4-carboxylic acid.
| Compound Name | ethane;N-ethyl-4-methoxypent-4-en-1-amine;1-[2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxy]ethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142218477 |
| Molecular Formula | C35H48N4O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | ethane;N-ethyl-4-methoxypent-4-en-1-amine;1-[2-[[2-(2-oxo-1H-quinolin-3-yl)-1H-indol-5-yl]oxy]ethyl]piperidine-4-carboxylic acid |
| SMILES | C=C(CCCNCC)OC.CC.O=C(O)C1CCN(CCOc2ccc3[nH]c(-c4cc5ccccc5[nH]c4=O)cc3c2)CC1 |
| InChI | InChI=1S/C25H25N3O4.C8H17NO.C2H6/c29-24-20(14-17-3-1-2-4-21(17)27-24)23-15-18-13-19(5-6-22(18)26-23)32-12-11-28-9-7-16(8-10-28)25(30)31;1-4-9-7-5-6-8(2)10-3;1-2/h1-6,13-16,26H,7-12H2,(H,27,29)(H,30,31);9H,2,4-7H2,1,3H3;1-2H3 |
| InChIKey | RKQPXRAICKAOTH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 119.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|