C26H21ClN5O+ — CID 142219624
[1-[(4-chlorophenyl)methyl]indol-3-yl]-[5-[(E)-(phenylhydrazinylidene)methyl]-1H-imidazol-3-ium-2-yl]methanone (PubChem CID 142219624) has the molecular formula C26H21ClN5O+ and a molecular weight of 454.94 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]indol-3-yl]-[5-[(E)-(phenylhydrazinylidene)methyl]-1H-imidazol-3-ium-2-yl]methanone.
| Compound Name | [1-[(4-chlorophenyl)methyl]indol-3-yl]-[5-[(E)-(phenylhydrazinylidene)methyl]-1H-imidazol-3-ium-2-yl]methanone |
|---|---|
| PubChem CID | 142219624 |
| Molecular Formula | C26H21ClN5O+ |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]indol-3-yl]-[5-[(E)-(phenylhydrazinylidene)methyl]-1H-imidazol-3-ium-2-yl]methanone |
| SMILES | O=C(c1[nH]c(/C=N/Nc2ccccc2)c[nH+]1)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H20ClN5O/c27-19-12-10-18(11-13-19)16-32-17-23(22-8-4-5-9-24(22)32)25(33)26-28-14-21(30-26)15-29-31-20-6-2-1-3-7-20/h1-15,17,31H,16H2,(H,28,30)/p+1/b29-15+ |
| InChIKey | YOGKRLAZMMJIHF-WKULSOCRSA-O |
| XLogP | 5.16 |
| TPSA | 76.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|