C21H27FN2O4 — CID 142221174
(2E,4E)-5-[2-amino-2-[5-(4-fluorophenoxy)pentylimino]ethoxy]-2-ethenylhexa-2,4-dienoic acid (PubChem CID 142221174) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is (2E,4E)-5-[2-amino-2-[5-(4-fluorophenoxy)pentylimino]ethoxy]-2-ethenylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[2-amino-2-[5-(4-fluorophenoxy)pentylimino]ethoxy]-2-ethenylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 142221174 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (2E,4E)-5-[2-amino-2-[5-(4-fluorophenoxy)pentylimino]ethoxy]-2-ethenylhexa-2,4-dienoic acid |
| SMILES | C=C/C(=C\C=C(/C)OC/C(N)=N/CCCCCOc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C21H27FN2O4/c1-3-17(21(25)26)8-7-16(2)28-15-20(23)24-13-5-4-6-14-27-19-11-9-18(22)10-12-19/h3,7-12H,1,4-6,13-15H2,2H3,(H2,23,24)(H,25,26)/b16-7+,17-8+ |
| InChIKey | JJGMHVMETCMDBR-GDWCLCACSA-N |
| XLogP | 3.85 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|