C26H32ClN5O2 — CID 142221561
7-chloro-6-[2-[(Z)-2-methylpent-2-enyl]iminoethyl]-2-N-(2-phenylcyclopropyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide (PubChem CID 142221561) has the molecular formula C26H32ClN5O2 and a molecular weight of 482.03 g/mol. Its IUPAC name is 7-chloro-6-[2-[(Z)-2-methylpent-2-enyl]iminoethyl]-2-N-(2-phenylcyclopropyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide.
| Compound Name | 7-chloro-6-[2-[(Z)-2-methylpent-2-enyl]iminoethyl]-2-N-(2-phenylcyclopropyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
|---|---|
| PubChem CID | 142221561 |
| Molecular Formula | C26H32ClN5O2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 7-chloro-6-[2-[(Z)-2-methylpent-2-enyl]iminoethyl]-2-N-(2-phenylcyclopropyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
| SMILES | CC/C=C(/C)C/N=C/Cc1c(Cl)c(C(N)=O)c2n1CCN(C(=O)NC1CC1c1ccccc1)C2 |
| InChI | InChI=1S/C26H32ClN5O2/c1-3-7-17(2)15-29-11-10-21-24(27)23(25(28)33)22-16-31(12-13-32(21)22)26(34)30-20-14-19(20)18-8-5-4-6-9-18/h4-9,11,19-20H,3,10,12-16H2,1-2H3,(H2,28,33)(H,30,34)/b17-7-,29-11+ |
| InChIKey | UEANROAVHNBBRO-ZEHMEHMLSA-N |
| XLogP | 4.29 |
| TPSA | 92.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|