C23H29N5O3 — CID 142221586
acetylene;7-cyano-6-[(2Z,4Z)-hexa-2,4-dienyl]-2-N-(oxan-4-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide (PubChem CID 142221586) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is acetylene;7-cyano-6-[(2Z,4Z)-hexa-2,4-dienyl]-2-N-(oxan-4-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide.
| Compound Name | acetylene;7-cyano-6-[(2Z,4Z)-hexa-2,4-dienyl]-2-N-(oxan-4-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
|---|---|
| PubChem CID | 142221586 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | acetylene;7-cyano-6-[(2Z,4Z)-hexa-2,4-dienyl]-2-N-(oxan-4-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
| SMILES | C#C.C/C=C\C=C/Cc1c(C#N)c(C(N)=O)c2n1CCN(C(=O)NC1CCOCC1)C2 |
| InChI | InChI=1S/C21H27N5O3.C2H2/c1-2-3-4-5-6-17-16(13-22)19(20(23)27)18-14-25(9-10-26(17)18)21(28)24-15-7-11-29-12-8-15;1-2/h2-5,15H,6-12,14H2,1H3,(H2,23,27)(H,24,28);1-2H/b3-2-,5-4-; |
| InChIKey | DQHZDPIEAUJSOL-PDPUUXMWSA-N |
| XLogP | 2.09 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|