C27H27N5 — CID 142224103
1-methyl-6-methylidene-2-[3-(4-phenylphenyl)piperidin-1-yl]-4-pyrimidin-4-ylpyrimidine (PubChem CID 142224103) has the molecular formula C27H27N5 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-methyl-6-methylidene-2-[3-(4-phenylphenyl)piperidin-1-yl]-4-pyrimidin-4-ylpyrimidine.
| Compound Name | 1-methyl-6-methylidene-2-[3-(4-phenylphenyl)piperidin-1-yl]-4-pyrimidin-4-ylpyrimidine |
|---|---|
| PubChem CID | 142224103 |
| Molecular Formula | C27H27N5 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-methyl-6-methylidene-2-[3-(4-phenylphenyl)piperidin-1-yl]-4-pyrimidin-4-ylpyrimidine |
| SMILES | C=C1C=C(c2ccncn2)N=C(N2CCCC(c3ccc(-c4ccccc4)cc3)C2)N1C |
| InChI | InChI=1S/C27H27N5/c1-20-17-26(25-14-15-28-19-29-25)30-27(31(20)2)32-16-6-9-24(18-32)23-12-10-22(11-13-23)21-7-4-3-5-8-21/h3-5,7-8,10-15,17,19,24H,1,6,9,16,18H2,2H3 |
| InChIKey | VOHXMISTLKONTA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |