C19H23N3 — CID 67057689
4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyrimidine (PubChem CID 67057689) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyrimidine.
| Compound Name | 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 67057689 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyrimidine |
| SMILES | C[C@@H]1CCCN1C1CC(c2ccc(-c3ccncn3)cc2)C1 |
| InChI | InChI=1S/C19H23N3/c1-14-3-2-10-22(14)18-11-17(12-18)15-4-6-16(7-5-15)19-8-9-20-13-21-19/h4-9,13-14,17-18H,2-3,10-12H2,1H3/t14-,17?,18?/m1/s1 |
| InChIKey | SQCJGKDEVGINLE-RWBZWWBESA-N |
| XLogP | 3.87 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |