C19H23N3O — CID 16666784
2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyridazin-3-one (PubChem CID 16666784) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyridazin-3-one.
| Compound Name | 2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 16666784 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]cyclobutyl]phenyl]pyridazin-3-one |
| SMILES | C[C@@H]1CCCN1C1CC(c2ccc(-n3ncccc3=O)cc2)C1 |
| InChI | InChI=1S/C19H23N3O/c1-14-4-3-11-21(14)18-12-16(13-18)15-6-8-17(9-7-15)22-19(23)5-2-10-20-22/h2,5-10,14,16,18H,3-4,11-13H2,1H3/t14-,16?,18?/m1/s1 |
| InChIKey | DYGOHAJYVLSOGH-MXWWQKGMSA-N |
| XLogP | 2.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |