C9H10O2 — CID 142224246
2,3,4,5-tetrahydro-1-benzofuran-2-carbaldehyde (PubChem CID 142224246) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1-benzofuran-2-carbaldehyde.
| Compound Name | 2,3,4,5-tetrahydro-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 142224246 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2,3,4,5-tetrahydro-1-benzofuran-2-carbaldehyde |
| SMILES | O=CC1CC2=C(C=CCC2)O1 |
| InChI | InChI=1S/C9H10O2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h2,4,6,8H,1,3,5H2 |
| InChIKey | ODJCMFRNSKJPGR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|