About 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium
3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium (PubChem CID 59106146) has the molecular formula C9H7O2Y-
and a molecular weight of 236.06 g/mol. Its IUPAC name is 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium.
Molecular Properties
| Compound Name | 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium |
| PubChem CID | 59106146 |
| Molecular Formula | C9H7O2Y- |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium |
| SMILES | O=CC1Cc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C9H7O2.Y/c10-6-8-5-7-3-1-2-4-9(7)11-8;/h2-4,6,8H,5H2;/q-1; |
| InChIKey | FZYZNJKFSWQIMS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium?
The IUPAC name of 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium (CID 59106146) is 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium.
What is the SMILES notation for 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium?
The canonical SMILES for 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium is O=CC1Cc2c[c-]ccc2O1.[Y].
What is the InChIKey of 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium?
The InChIKey is FZYZNJKFSWQIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7O2.Y/c10-6-8-5-7-3-1-2-4-9(7)11-8;/h2-4,6,8H,5H2;/q-1;.
What are the key properties of 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium?
3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium has a molecular weight of 236.06 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydro-2H-1-benzofuran-5-ide-2-carbaldehyde;yttrium is sourced from PubChem (CID 59106146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).