C10H9O2Y- — CID 59106151
1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)ethanone;yttrium (PubChem CID 59106151) has the molecular formula C10H9O2Y- and a molecular weight of 250.09 g/mol. Its IUPAC name is 1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)ethanone;yttrium.
| Compound Name | 1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)ethanone;yttrium |
|---|---|
| PubChem CID | 59106151 |
| Molecular Formula | C10H9O2Y- |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 1-(3,5-dihydro-2H-1-benzofuran-5-id-2-yl)ethanone;yttrium |
| SMILES | CC(=O)C1Cc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C10H9O2.Y/c1-7(11)10-6-8-4-2-3-5-9(8)12-10;/h3-5,10H,6H2,1H3;/q-1; |
| InChIKey | AKHHRFNUPPGVAM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|