About 2,6a-dihydrofuro[2,3-h]chromen-6-one
2,6a-dihydrofuro[2,3-h]chromen-6-one (PubChem CID 89392458) has the molecular formula C11H8O3
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2,6a-dihydrofuro[2,3-h]chromen-6-one.
Molecular Properties
| Compound Name | 2,6a-dihydrofuro[2,3-h]chromen-6-one |
| PubChem CID | 89392458 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2,6a-dihydrofuro[2,3-h]chromen-6-one |
| SMILES | O=C1C=C2C=CCOC2=C2C=COC12 |
| InChI | InChI=1S/C11H8O3/c12-9-6-7-2-1-4-13-10(7)8-3-5-14-11(8)9/h1-3,5-6,11H,4H2 |
| InChIKey | PAHVHWOPFSEUJQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6a-dihydrofuro[2,3-h]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6a-dihydrofuro[2,3-h]chromen-6-one?
The IUPAC name of 2,6a-dihydrofuro[2,3-h]chromen-6-one (CID 89392458) is 2,6a-dihydrofuro[2,3-h]chromen-6-one.
What is the SMILES notation for 2,6a-dihydrofuro[2,3-h]chromen-6-one?
The canonical SMILES for 2,6a-dihydrofuro[2,3-h]chromen-6-one is O=C1C=C2C=CCOC2=C2C=COC12.
What is the InChIKey of 2,6a-dihydrofuro[2,3-h]chromen-6-one?
The InChIKey is PAHVHWOPFSEUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3/c12-9-6-7-2-1-4-13-10(7)8-3-5-14-11(8)9/h1-3,5-6,11H,4H2.
What are the key properties of 2,6a-dihydrofuro[2,3-h]chromen-6-one?
2,6a-dihydrofuro[2,3-h]chromen-6-one has a molecular weight of 188.18 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6a-dihydrofuro[2,3-h]chromen-6-one is sourced from PubChem (CID 89392458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).